For research use only. Not for therapeutic Use.
Toluene-d8 is a deuterated form of toluene where all eight hydrogen atoms are replaced with deuterium (heavy hydrogen). This isotopically labeled compound is widely used in nuclear magnetic resonance (NMR) spectroscopy as a solvent, providing a clear and stable medium for analyzing organic molecules. Its deuterium atoms prevent interference with the sample’s NMR signals, ensuring accurate spectral data. Toluene-d8 is also used in studies of reaction mechanisms, kinetic isotope effects, and as a tracer in various chemical processes, making it essential in both pharmaceutical and organic chemistry research.
CAS Number | 2037-26-5 |
Synonyms | 6-(Methyl-d3)-benzene-1,2,3,4,5-d5; Methyl-d3-Benzene-d5; Perdeuteriotoluene; [2H8]Toluene; |
Molecular Formula | C7H8 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
InChI | InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i1D3,2D,3D,4D,5D,6D |
InChIKey | YXFVVABEGXRONW-JGUCLWPXSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[2H])[2H])[2H] |