Tolvaptan（Cat No.:A000286）is a vasopressin V2 receptor antagonist used primarily to treat hyponatremia and autosomal dominant polycystic kidney disease (ADPKD). By inhibiting vasopressin, it promotes water excretion without significant loss of electrolytes, effectively increasing serum sodium levels in patients with heart failure and SIADH. In ADPKD, Tolvaptan slows the progression of kidney cyst growth and preserves renal function. This targeted therapy offers a significant clinical benefit by managing electrolyte imbalances and delaying disease progression, improving the quality of life for patients with these challenging conditions.
| Catalog Number | A000286 |
| CAS Number | 150683-30-0 |
| Synonyms | 150683-30-0; Samsca; OPC-41061; N-(4-(7-Chloro-5-hydroxy-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carbonyl)-3-methylphenyl)-2-methylbenzamide; OPC 41061 |
| Molecular Formula | C26H25ClN2O3 |
| Purity | ≥95% |
| Target | Vasopressin Receptor |
| Solubility | >17.8mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | N-[4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-3-methylphenyl]-2-methylbenzamide |
| InChI | InChI=1S/C26H25ClN2O3/c1-16-6-3-4-7-20(16)25(31)28-19-10-11-21(17(2)14-19)26(32)29-13-5-8-24(30)22-15-18(27)9-12-23(22)29/h3-4,6-7,9-12,14-15,24,30H,5,8,13H2,1-2H3,(H,28,31) |
| InChIKey | GYHCTFXIZSNGJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)N3CCCC(C4=C3C=CC(=C4)Cl)O)C |
