For research use only. Not for therapeutic Use.
Topoisomerase II inhibitor 13（Cat No.:I041276）is a small molecule compound that specifically targets and inhibits the activity of topoisomerase II, an enzyme critical for DNA replication and cell division. By interfering with the enzyme’s ability to untangle DNA during cell division, it induces DNA damage, leading to cell cycle arrest and apoptosis, particularly in rapidly dividing cancer cells. This makes Topoisomerase II inhibitor 13 a promising candidate for cancer treatment, with potential applications in treating various malignancies. Ongoing research is exploring its efficacy, safety, and optimal use in clinical oncology.
| CAS Number | 451515-89-2 |
| Synonyms | 6-amino-7-(1H-benzimidazol-2-yl)-5-[3-(diethylamino)propyl]pyrrolo[2,3-b]pyrazine-2,3-dicarbonitrile |
| Molecular Formula | C22H23N9 |
| Purity | ≥95% |
| IUPAC Name | 6-amino-7-(1H-benzimidazol-2-yl)-5-[3-(diethylamino)propyl]pyrrolo[2,3-b]pyrazine-2,3-dicarbonitrile |
| InChI | InChI=1S/C22H23N9/c1-3-30(4-2)10-7-11-31-20(25)18(21-27-14-8-5-6-9-15(14)28-21)19-22(31)29-17(13-24)16(12-23)26-19/h5-6,8-9H,3-4,7,10-11,25H2,1-2H3,(H,27,28) |
| InChIKey | SZUYNNSSCOCFTF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCN1C(=C(C2=NC(=C(N=C21)C#N)C#N)C3=NC4=CC=CC=C4N3)N |
