For research use only. Not for therapeutic Use.
Torcitabine(Cat No.:I015360), also known as BCH-189, is an antiviral nucleoside analog primarily investigated for its potential in treating hepatitis B virus (HBV) and HIV infections. It acts by incorporating itself into viral DNA, effectively inhibiting reverse transcriptase and viral replication. Torcitabine showed promise in early studies for reducing viral load, particularly in cases resistant to other antiviral therapies. However, due to toxicity concerns, its development for HIV and HBV treatment has been limited. Despite these challenges, torcitabine remains a molecule of interest in antiviral research for its unique mechanism.
CAS Number | 40093-94-5 |
Molecular Formula | C₉H₁₃N₃O₄ |
Purity | ≥95% |
Target | HBV |
IUPAC Name | 4-amino-1-[(2S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
InChI | InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m1/s1 |
InChIKey | CKTSBUTUHBMZGZ-CHKWXVPMSA-N |
SMILES | C1[C@H]([C@@H](O[C@@H]1N2C=CC(=NC2=O)N)CO)O |
Reference | [1]. Buti M, et al. Drugs in development for hepatitis B. Drugs. 2005;65(11):1451‐1460.<br>[2]. Keam SJ. Telbivudine. Drugs. 2007;67(13):1917‐1929. |