For research use only. Not for therapeutic Use.
Tos-PEG2-C2-Boc（Cat No.:I016903）is a synthetic chemical compound used in peptide and drug development, often in research settings. It is a modified linker molecule consisting of a tosyl group (Tos), polyethylene glycol (PEG) chain, a C2 (ethylene) spacer, and a Boc (tert-butoxycarbonyl) protective group. The tosyl group is typically used for coupling reactions, while the PEG chain provides solubility and flexibility to the compound. The Boc group protects amino acids or other functional groups during synthesis. This compound is valuable in creating peptide conjugates or drug delivery systems due to its stability and versatility in bioconjugation processes.
| CAS Number | 850090-13-0 |
| Molecular Formula | C₁₈H₂₈O₇S |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| IUPAC Name | tert-butyl 3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C18H28O7S/c1-15-5-7-16(8-6-15)26(20,21)24-14-13-23-12-11-22-10-9-17(19)25-18(2,3)4/h5-8H,9-14H2,1-4H3 |
| InChIKey | ATHTXRBMNTZSMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCC(=O)OC(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
