For research use only. Not for therapeutic Use.
Toxicarol Isoflavone(CAT: I012969) is a naturally occurring isoflavone compound known for its potential antioxidant and anti-inflammatory properties. Isoflavones, as phytoestrogens, can modulate various biological pathways, and Toxicarol Isoflavone may interact with cellular signaling involved in oxidative stress and inflammation. It holds promise in oncology and neuroprotection research due to its ability to regulate cell proliferation and apoptosis. Though detailed studies on Toxicarol Isoflavone are limited, its structural similarity to other bioactive isoflavones suggests potential therapeutic applications in cancer prevention, neurodegenerative disease research, and inflammatory condition management.
CAS Number | 3044-60-8 |
Molecular Formula | C₂₃H₂₂O₇ |
Purity | ≥95% |
Target | Disease Research Fields |
Solubility | DMSO |
IUPAC Name | 5-hydroxy-8,8-dimethyl-3-(2,4,5-trimethoxyphenyl)pyrano[2,3-h]chromen-4-one |
InChI | InChI=1S/C23H22O7/c1-23(2)7-6-12-17(30-23)9-15(24)20-21(25)14(11-29-22(12)20)13-8-18(27-4)19(28-5)10-16(13)26-3/h6-11,24H,1-5H3 |
InChIKey | WNIRAQXHOVJVDB-UHFFFAOYSA-N |
SMILES | CC1(C=CC2=C3C(=C(C=C2O1)O)C(=O)C(=CO3)C4=CC(=C(C=C4OC)OC)OC)C |