For research use only. Not for therapeutic Use.
Toxoflavin is a potent bacterial toxin and an inhibitor of the cytochrome P450 enzyme system, primarily involved in disrupting cellular metabolic processes. It has been studied for its potential antimicrobial properties, particularly in targeting Gram-negative bacteria. In biochemical research, Toxoflavin serves as a valuable tool for understanding bacterial pathogenesis and enzyme inhibition. Its mechanism of action includes the inhibition of flavoproteins, offering insight into microbial defense mechanisms and cellular response to oxidative stress.
CAS Number | 84-82-2 |
Synonyms | NSC 67078;SID 4251194;Toxoflavin;Xanthothricin |
Molecular Formula | C7H7N5O2 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | 1,6-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
InChI | InChI=1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
InChIKey | SLGRAIAQIAUZAQ-UHFFFAOYSA-N |
SMILES | CN1C2=NC(=O)N(C(=O)C2=NC=N1)C |