For research use only. Not for therapeutic Use.
TP-030-2(Cat No.:I042640)is a selective small molecule inhibitor designed to target specific enzymes involved in cellular signaling pathways, particularly those associated with cancer and other diseases. It works by modulating key proteins that regulate cell growth, survival, and apoptosis. TP-030-2 has shown promise in preclinical studies for its ability to disrupt aberrant signaling in tumor cells, making it a potential therapeutic agent for oncology. Researchers are investigating its use in combination therapies to enhance the effectiveness of existing cancer treatments, offering a new approach to targeted cancer therapy.
CAS Number | 2095514-84-2 |
Synonyms | (3S)-3-(2-benzyl-3-bromo-7-oxo-4,5-dihydropyrazolo[3,4-c]pyridin-6-yl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
Molecular Formula | C23H21BrN4O3 |
Purity | ≥95% |
IUPAC Name | (3S)-3-(2-benzyl-3-bromo-7-oxo-4,5-dihydropyrazolo[3,4-c]pyridin-6-yl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
InChI | InChI=1S/C23H21BrN4O3/c1-26-17-9-5-6-10-19(17)31-14-18(22(26)29)27-12-11-16-20(23(27)30)25-28(21(16)24)13-15-7-3-2-4-8-15/h2-10,18H,11-14H2,1H3/t18-/m0/s1 |
InChIKey | KHVVJKLNKLQLJZ-SFHVURJKSA-N |
SMILES | CN1C2=CC=CC=C2OC[C@@H](C1=O)N3CCC4=C(N(N=C4C3=O)CC5=CC=CC=C5)Br |