For research use only. Not for therapeutic Use.
TPCK (Cat No.:R041811) is a potent serine protease inhibitor, primarily used in biochemical research to study protease activity. TPCK inhibits enzymes like trypsin and chymotrypsin by binding to the active site, preventing substrate cleavage. Its specificity makes it a valuable tool for investigating the role of serine proteases in various biological processes, such as digestion, blood clotting, and immune response. TPCK is often used in enzyme assays, protease inhibition studies, and in experiments exploring the regulation of protease activity in cellular functions and disease mechanisms.
| CAS Number | 402-71-1 |
| Synonyms | N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| Molecular Formula | C17H18ClNO3S |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| InChI | InChI=1S/C17H18ClNO3S/c1-13-7-9-15(10-8-13)23(21,22)19-16(17(20)12-18)11-14-5-3-2-4-6-14/h2-10,16,19H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | MQUQNUAYKLCRME-INIZCTEOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC2=CC=CC=C2)C(=O)CCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
