For research use only. Not for therapeutic Use.
TPEN (N,N,N’,N’-Tetra(n-butyl)ethylenediamine) (Cat No.: I002201)is a synthetic chelating agent used in biochemical and pharmacological research. Known for its ability to selectively bind to metal ions such as zinc and copper, TPEN plays a crucial role in studying metal ion homeostasis and their involvement in various cellular processes. It is commonly used to investigate the effects of metal ion depletion on enzyme activity, signaling pathways, and oxidative stress. TPEN provides valuable insights into metal ion regulation in biological systems.
Catalog Number | I002201 |
CAS Number | 16858-02-9 |
Synonyms | N1,N1,N2,N2-tetrakis(pyridin-2-ylmethyl)ethane-1,2-diamine |
Molecular Formula | C26H28N6 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Solubility | 10 mM in DMSO |
Storage | Store at +4℃ |
IUPAC Name | N,N,N',N'-tetrakis(pyridin-2-ylmethyl)ethane-1,2-diamine |
InChI | InChI=1S/C26H28N6/c1-5-13-27-23(9-1)19-31(20-24-10-2-6-14-28-24)17-18-32(21-25-11-3-7-15-29-25)22-26-12-4-8-16-30-26/h1-16H,17-22H2 |
InChIKey | CVRXLMUYFMERMJ-UHFFFAOYSA-N |
SMILES | c1ccc(nc1)CN(CCN(Cc1ccccn1)Cc1ccccn1)Cc1ccccn1 |