For research use only. Not for therapeutic Use.
TPY-5628 (CAT: I009866) is a valuable intermediate compound widely utilized in the chemical synthesis of various biologically significant molecules. It serves as a building block for the synthesis of diverse compounds, including porphyrins, bile pigments, photosensitizers, and anticancer drugs. Porphyrins play a crucial role in various biological processes, such as oxygen transport (hemoglobin) and electron transfer (cytochromes). Bile pigments, like bilirubin, are involved in the metabolism of heme and liver function. Photosensitizers are used in photodynamic therapy to selectively destroy cancer cells. TPY-5628’s versatility and utility as an intermediate make it valuable for the synthesis of these important molecules.
CAS Number | 149365-62-8 |
Synonyms | TPY-5628; TPY 5628; TPY5628.;5,5/’-((3,4-diethyl-1H-pyrrole-2,5-diyl)bis(methylene))bis(4-(3-hydroxypropyl)-3-methyl-1H-pyrrole-2-carbaldehyde) |
Molecular Formula | C28H39N3O4 |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 5-[[3,4-diethyl-5-[[5-formyl-3-(3-hydroxypropyl)-4-methyl-1H-pyrrol-2-yl]methyl]-1H-pyrrol-2-yl]methyl]-4-(3-hydroxypropyl)-3-methyl-1H-pyrrole-2-carbaldehyde |
InChI | InChI=1S/C28H39N3O4/c1-5-19-20(6-2)24(14-26-22(10-8-12-33)18(4)28(16-35)31-26)29-23(19)13-25-21(9-7-11-32)17(3)27(15-34)30-25/h15-16,29-33H,5-14H2,1-4H3 |
InChIKey | OOOQNKMJLOLMHC-UHFFFAOYSA-N |
SMILES | CCC1=C(NC(=C1CC)CC2=C(C(=C(N2)C=O)C)CCCO)CC3=C(C(=C(N3)C=O)C)CCCO |