For research use only. Not for therapeutic Use.
Trabectedin is a potent anticancer agent derived from Ecteinascidia turbinate, a marine organism. It inhibits DNA repair mechanisms by binding to the minor groove of DNA, disrupting transcription and inducing cell death in cancer cells. Primarily used in the treatment of soft tissue sarcoma and ovarian cancer, Trabectedin is known for its unique mechanism, bypassing common resistance mechanisms seen in other chemotherapeutics. Its efficacy, combined with manageable side effects, makes it a valuable option in cancer therapy.
| Catalog Number | I000554 |
| CAS Number | 114899-77-3 |
| Molecular Formula | C39H43N3O11S |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 0.1-3.7 nM (breast cancer cell lines) |
| IUPAC Name | [(1R,2R,3R,11S,12S,14R,26R)-5,6',12-trihydroxy-6,7'-dimethoxy-7,21,30-trimethyl-27-oxospiro[17,19,28-trioxa-24-thia-13,30-diazaheptacyclo[12.9.6.13,11.02,13.04,9.015,23.016,20]triaconta-4(9),5,7,15,20,22-hexaene-26,1'-3,4-dihydro-2H-isoquinoline]-22-yl] acetate |
| InChI | 1S/C39H43N3O11S/c1-16-9-20-10-22-37(46)42-23-13-50-38(47)39(21-12-25(48-5)24(44)11-19(21)7-8-40-39)14-54-36(30(42)29(41(22)4)26(20)31(45)32(16)49-6)28-27(23)35-34(51-15-52-35)17(2)33(28)53-18(3)43/h9,11-12,22-23,29-30,36-37,40,44-46H,7-8,10,13-15H2,1-6H3/t22-,23-,29+,30+,36+,37-,39+/m0/s1 |
| InChIKey | PKVRCIRHQMSYJX-AIFWHQITSA-N |
| SMILES | CC1=C(OC)C(O)=C2C3[C@@H]4[C@@H]5C6=C(C7=C(OCO7)C(C)=C6OC(C)=O)[C@@H](COC(C8(C9=CC(OC)=C(O)C=C9CCN8)CS5)=O)N4C(O)C(CC2=C1)N3C |
