For research use only. Not for therapeutic Use.
Tracazolate hydrochloride (Cat.No:I010274) is a novel GABAA receptor modulator. It acts as a positive allosteric modulator, enhancing the activity of the GABAA receptor, which is involved in inhibitory neurotransmission in the brain. Tracazolate hydrochloride has been investigated for its potential as an anxiolytic and anticonvulsant agent in preclinical studies.
| Catalog Number | I010274 |
| CAS Number | 1135210-68-2 |
| Synonyms | Alternative Name: ICI 136753 |
| Molecular Formula | C16H25ClN4O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in 1eq. HCl |
| Storage | Desiccate at RT |
| IUPAC Name | ethyl 4-(butylamino)-1-ethyl-6-methylpyrazolo[3,4-b]pyridine-5-carboxylate;hydrochloride |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-5-8-9-17-14-12-10-18-20(6-2)15(12)19-11(4)13(14)16(21)22-7-3;/h10H,5-9H2,1-4H3,(H,17,19);1H |
| InChIKey | TUIXDPUEMQXVHO-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C2C=NN(C2=NC(=C1C(=O)OCC)C)CC.Cl |
