For research use only. Not for therapeutic Use.
Trachelogenin（Cat No.:I043275）is a bioactive compound derived from the plant Trachelospermum jasminoides, commonly known as star jasmine. It is a flavonoid glycoside, known for its antioxidant, anti-inflammatory, and potential anticancer properties. Trachelogenin has been studied for its ability to modulate various cellular processes, including reducing oxidative stress and inflammatory responses. Due to its promising bioactivity, it is being explored for therapeutic applications, particularly in skin care and anti-aging products. Additionally, its potential use in the treatment of inflammatory and oxidative stress-related diseases is under ongoing research.
| CAS Number | 34209-69-3 |
| Synonyms | (3S,4S)-4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| Molecular Formula | C21H24O7 |
| Purity | ≥95% |
| IUPAC Name | (3S,4S)-4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| InChI | InChI=1S/C21H24O7/c1-25-17-7-5-13(9-19(17)27-3)8-15-12-28-20(23)21(15,24)11-14-4-6-16(22)18(10-14)26-2/h4-7,9-10,15,22,24H,8,11-12H2,1-3H3/t15-,21-/m0/s1 |
| InChIKey | YFVZKLQNMNKWSB-BTYIYWSLSA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@H]2COC(=O)[C@@]2(CC3=CC(=C(C=C3)O)OC)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
