For research use only. Not for therapeutic Use.
Tranexamic Acid-13C2,15N(CAT: C000345) is a specialized isotopically labeled form of tranexamic acid. This compound is often utilized in medical and pharmaceutical research, particularly in pharmacokinetic and bioavailability studies. The incorporation of stable isotopes like carbon-13 and nitrogen-15 allows researchers to trace the compound’s metabolic pathways and interactions within biological systems with greater precision.
| Catalog Number | C000345 |
| CAS Number | 1292837-95-6 |
| Synonyms | trans-4-(Aminomethyl)cyclohexanecarboxylic Acid-13C2,15N; trans-p-(Aminomethyl) |
| Molecular Formula | C₆¹³C₂H₁₅¹⁵NO₂ |
| Purity | ≥95% |
| Solubility | Water (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid |
| InChI | InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11)/i5+1,8+1,9+1 |
| InChIKey | GYDJEQRTZSCIOI-XGOBPNGOSA-N |
| SMILES | C1CC(CCC1[13CH2][15NH2])[13C](=O)O |
