For research use only. Not for therapeutic Use.
Trans-3-Ethoxycinnamic acid(Cat No.:M012352) is a derivative of cinnamic acid, where an ethoxy group is attached at the third position of the trans-cinnamic acid backbone. This structural modification enhances its solubility and alters its chemical properties. Commonly used in the synthesis of various organic compounds, trans-3-ethoxy cinnamic acid exhibits UV absorption properties, making it useful in sunscreen formulations and other cosmetic products to protect against UV radiation. Additionally, it is studied for its potential anti-inflammatory and antioxidant activities, which may have applications in pharmaceuticals and as a functional additive in nutraceuticals and food products.
CAS Number | 103986-73-8 |
Molecular Formula | C11H12O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (E)-3-(3-ethoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C11H12O3/c1-2-14-10-5-3-4-9(8-10)6-7-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b7-6+ |
InChIKey | DOEYODSOYOGJQH-VOTSOKGWSA-N |
SMILES | CCOC1=CC=CC(=C1)C=CC(=O)O |