For research use only. Not for therapeutic Use.
Trans-3-hydroxyproline(Cat No.:R019018), is an amino acid derivative that plays a critical role in the structure and stability of collagen, a major protein found in connective tissues like skin, tendons, and bones. It is a naturally occurring compound and a key component of collagen’s triple helix structure. Trans-3-hydroxyproline is not one of the standard amino acids incorporated into proteins during translation, but it is post-translationally added to collagen chains during their biosynthesis. This hydroxylation process is essential for collagen’s strength and stability, and it contributes to the overall health and integrity of connective tissues in the body.
CAS Number | 4298-08-2 |
Synonyms | (3S)-3-Hydroxy-L-proline; (2S,3S)-(-)-3-Hydroxy-L-proline; (2S,3S)-3-Hydroxyproline; trans-3-Hydroxy-L-proline |
Molecular Formula | C5H9NO3 |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | (2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m0/s1 |
InChIKey | BJBUEDPLEOHJGE-IMJSIDKUSA-N |
SMILES | C1CNC(C1O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |