For research use only. Not for therapeutic Use.
Trans-3-indole acrylic acid(Cat No.:I018190) is an endogenous metabolite derived from the amino acid tryptophan. It is formed through the enzymatic conversion of tryptophan to indole pyruvate, which is then further metabolized to trans-3-indole acrylic acid. This metabolite plays a role in various physiological processes, including neurotransmitter synthesis, immune modulation, and regulation of oxidative stress. Its levels and activity have been implicated in the pathogenesis of certain diseases, such as inflammation, neurological disorders, and cancer, making it a subject of interest in biomedical research and potential therapeutic interventions.
CAS Number | 29953-71-7 |
Molecular Formula | C₁₁H₉NO₂ |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | (E)-3-(1H-indol-3-yl)prop-2-enoic acid |
InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14)/b6-5+ |
InChIKey | PLVPPLCLBIEYEA-AATRIKPKSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |