For research use only. Not for therapeutic Use.
trans-4-Hydroxy-L-proline (Cat No.:R050109) is a common non-standard protein amino acid with high application value as the main raw material of the antiviral drug atazanavir. trans-4-Hydroxy-L-proline is generally used as a flavor enhancer; nutritional fortification; aroma ingredient，etc.
| Catalog Number | R050109 |
| CAS Number | 51-35-4 |
| Synonyms | (-)-4-Hydroxy-2-pyrrolidinecarboxylic Acid; (2S,4R)-(-)-4-Hydroxyproline; (R)-4-Hydroxy-(S)-proline; 4(R)-Hydroxy-2(S)-pyrrolidinecarboxylic Acid; 4-trans-Hydroxy-L-proline; L-Hypro; NSC 46704; |
| Molecular Formula | C5H9NO3 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | PMMYEEVYMWASQN-DMTCNVIQSA-N |
| SMILES | C1C(CNC1C(=O)O)O |
| Reference | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1. Tetrahedron Letters 35, 6163-6163, (1994) <br /> |
