For research use only. Not for therapeutic Use.
trans-Chalcone(Cat No.:R024525)is a naturally occurring flavonoid and precursor in the biosynthesis of other flavonoids. Known for its antioxidant, anti-inflammatory, and anticancer properties, trans-Chalcone inhibits enzymes like xanthine oxidase and cyclooxygenase, reducing oxidative stress and inflammation. It has been studied for its potential to induce apoptosis and inhibit the growth of cancer cells, making it a compound of interest in cancer research. Additionally, trans-Chalcone has antimicrobial and antifungal activities, further broadening its therapeutic potential. Its diverse biological activities make it valuable in medicinal chemistry and pharmaceutical research.
CAS Number | 614-47-1 |
Synonyms | (2E)-1,3-Diphenyl-2-propen-1-one; (E)-1,3-Diphenyl-2-propen-1-one; (E)-1,3-Diphenyl-2-propen-1-one; (E)-1,3-Diphenylpropen-3-one; (E)-1,3-Diphenylpropenone; (E)-1-Benzoyl-2-phenylethylene; (E)-Benzalacetophenone; (E)-Benzylideneacetophenone; (E)-Chal |
Molecular Formula | C15H12O |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (E)-1,3-diphenylprop-2-en-1-one |
InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11+ |
InChIKey | DQFBYFPFKXHELB-VAWYXSNFSA-N |
SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |