For research use only. Not for therapeutic Use.
trans-Ferulic Acid is a naturally occurring phenolic acid commonly found in plant cell walls, particularly in cereals and vegetables. It exhibits significant antioxidant, anti-inflammatory, and anticancer properties, making it valuable for pharmaceutical and nutritional research. Known for its potential in protecting against oxidative stress and inflammation, trans-Ferulic Acid is explored for its therapeutic applications in cardiovascular health, neurodegenerative diseases, and cancer prevention. Its versatile biological activities make it an essential compound in medicinal chemistry and natural product research.
CAS Number | 537-98-4 |
Synonyms | (2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid;?(E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid; (E)-4-Hydroxy-3-methoxy-cinnamic acid; (2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-acrylic acid; (2E)-3-(4-Hydroxy-3-methoxyphenyl)prop-2-enoic acid; (E |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
InChIKey | KSEBMYQBYZTDHS-HWKANZROSA-N |
SMILES | COC1=C(C=CC(=C1)C=CC(=O)O)O |