For research use only. Not for therapeutic Use.
trans-ISRIB（Cat No.:I002023）is a selective inhibitor of the integrated stress response (ISR), targeting the protein kinase eIF2α. By inhibiting this pathway, trans-ISRIB can enhance protein translation and promote cell survival under stress conditions, making it a valuable tool in cancer research and neuroprotection. Preclinical studies have demonstrated its potential to improve cognitive function in models of neurodegenerative diseases and to enhance the efficacy of certain cancer therapies. Its ability to modulate the ISR highlights its therapeutic potential in conditions where cellular stress responses are dysregulated, paving the way for innovative treatment strategies.
| Catalog Number | I002023 |
| CAS Number | 1597403-47-8 |
| Synonyms | N,N/’-((1s,4s)-cyclohexane-1,4-diyl)bis(2-(4-chlorophenoxy)acetamide) |
| Molecular Formula | C22H24Cl2N2O4 |
| Purity | ≥95% |
| Target | PERK |
| Solubility | DMSO: ≥ 38 mg/mL |
| Storage | Store at -20°C |
| IC50 | 5 nM [1] |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]acetamide |
| InChI | InChI=1S/C22H24Cl2N2O4/c23-15-1-9-19(10-2-15)29-13-21(27)25-17-5-7-18(8-6-17)26-22(28)14-30-20-11-3-16(24)4-12-20/h1-4,9-12,17-18H,5-8,13-14H2,(H,25,27)(H,26,28) |
| InChIKey | HJGMCDHQPXTGAV-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC(=O)COC2=CC=C(C=C2)Cl)NC(=O)COC3=CC=C(C=C3)Cl |
| Reference | <p style=/line-height:25px/> |
