For research use only. Not for therapeutic Use.
trans-Melilotoside (compound 3) is a natural product that could be isolated form Mikania laevigata[1].
| Catalog Number | I041922 |
| CAS Number | 618-67-7 |
| Synonyms | (E)-3-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
| Molecular Formula | C15H18O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-2-1-3-8(9)5-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-5+/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | GVRIYIMNJGULCZ-ZMKUSUEASA-N |
| SMILES | C1=CC=C(C(=C1)C=CC(=O)O)OC2C(C(C(C(O2)CO)O)O)O |
| Reference | [1]. Assunta E, et, al. Potential allelopathic interference of Melilotus neapolitana metabolites on three coexisting species of Mediterranean herbaceous plant community. Journal of Plant Interactions. 2008;3(3): 199-210. |
