For research use only. Not for therapeutic Use.
trans-Methyl-2-butenal is a high-purity compound essential for advanced pharmaceutical and chemical research. This α,β-unsaturated aldehyde is crucial for studies involving organic synthesis, flavor and fragrance development, and chemical intermediates. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R020973 |
CAS Number | 497-03-0 |
Synonyms | Tiglaldehyde; (2E)-2-Methyl-2-butenal; (E)-2-Methyl-2-butenal; (E)-2-Methyl-2-butenal; (E)-2-Methylbut-2-en-1-al; NSC 2179; Tiglic Aldehyde; trans-2-Methyl-2-butenal; trans-Tiglaldehyde |
Molecular Formula | C5H8O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-2-methylbut-2-enal |
InChI | InChI=1S/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
InChIKey | ACWQBUSCFPJUPN-HWKANZROSA-N |
SMILES | CC=C(C)C=O |