For research use only. Not for therapeutic Use.
trans-N-(3-Chloroallyl)-1-(R)-aminoindan hydrochloride (Cat No.:C000775) is a chemical compound with a chlorophyll group and an (R)-aminoindan moiety linked through a trans arrangement. This intricate structure suggests potential significance in medicinal chemistry. The compound’s unique configuration may influence its interactions with biological systems, making it of interest to researchers exploring potential therapeutic applications.
| Catalog Number | C000775 |
| CAS Number | 1175018-78-6 |
| Synonyms | (1R)-N-[(2E)-3-chloro-2-propen-1-yl]-2,3-dihydro-1H-Inden-1-amine Hydrochloride (1:1) |
| Molecular Formula | C₁₂H₁₄ClN • (HCl) |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | (1R)-N-[(E)-3-chloroprop-2-enyl]-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChI | InChI=1S/C12H14ClN.ClH/c13-8-3-9-14-12-7-6-10-4-1-2-5-11(10)12;/h1-5,8,12,14H,6-7,9H2;1H/b8-3+;/t12-;/m1./s1 |
| InChIKey | XSGWVDYIYJOVCZ-COUKRICUSA-N |
| SMILES | C1CC2=CC=CC=C2C1NCC=CCl.Cl |
| Reference | Sterling, Jeffrey, et al.: Teva Pharmaceutical Industries, US 7572834 (2009) |
