For research use only. Not for therapeutic Use.
trans-p-Coumaric Acid(Cat No.:R040329)is a naturally occurring phenolic acid found in various plants, fruits, and vegetables. It is characterized by a trans configuration of the hydroxylated cinnamic acid structure. Known for its antioxidant, anti-inflammatory, and antimicrobial properties, trans-p-Coumaric Acid plays a crucial role in plant defense mechanisms. It is also studied for its potential health benefits, including reducing the risk of chronic diseases such as cancer and cardiovascular disorders. In addition to its biological significance, it is used in food, cosmetic, and pharmaceutical industries for its preservative and health-promoting qualities.
CAS Number | 501-98-4 |
Synonyms | (2E)-(4-Hydroxyphenyl)-2-coumaric Acid; (2E)-(4-Hydroxyphenyl)-2-propenoic Acid; (E)-3-(4-Hydroxyphenyl)-2-propenoic Acid; (E)-3-(4-Hydroxyphenyl)acrylic Acid; (E)-4-Hydroxycinnamic Acid; (E)-p-Coumaric Acid; (E)-p-Hydroxycinnamic Acid; Naringeninic |
Molecular Formula | C9H8O3 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Room temperature |
IUPAC Name | (E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
InChIKey | NGSWKAQJJWESNS-ZZXKWVIFSA-N |
SMILES | C1=CC(=CC=C1C=CC(=O)O)O |