For research use only. Not for therapeutic Use.
Trans-p-Methoxycinnamaldehyde (Cat.No:R041825) is a natural compound found in cinnamon essential oil. It exhibits antimicrobial properties and is used in food and cosmetic industries for its flavor and fragrance. Additionally, it shows potential in pharmaceuticals for its anti-inflammatory and antioxidant effects, making it a versatile compound with various applications.
CAS Number | 24680-50-0 |
Synonyms | (2E)-3-(4-Methoxyphenyl)-2-propenal; (E)-3-(4-Methoxyphenyl)-2-propenal; (E)-p-Methoxy-Cinnamaldehyde; (2E)-3-(4-Methoxyphenyl)-2-propenal; (E)-3-(4-Methoxyphenyl)-2-propenal; (E)-3-(4-Methoxyphenyl)propenal; (E)-3-(4-Methoxyphenyl)propenal; (E)-4-Me |
Molecular Formula | C10H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-3-(4-methoxyphenyl)prop-2-enal |
InChI | InChI=1S/C10H10O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-8H,1H3/b3-2+ |
InChIKey | AXCXHFKZHDEKTP-NSCUHMNNSA-N |
SMILES | COC1=CC=C(C=C1)C=CC=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |