For research use only. Not for therapeutic Use.
(+/-)-trans Taxifolin (Cat No.: R000843) is a flavonoid compound found in various plants, including onions, grapes, and apples. It exhibits a range of potential health benefits, including antioxidant, anti-inflammatory, and cardioprotective effects. Studies suggest that taxifolin may help reduce oxidative stress, protect vascular health, and reduce the risk of chronic diseases such as heart disease and diabetes. It is also being researched for its potential in cancer prevention due to its ability to modulate cell signaling pathways.
| Catalog Number | R000843 |
| CAS Number | 24198-97-8 |
| Synonyms | Dihydroquercetin; 3,3’,4’,5,7-Pentahydroxyflavanone |
| Molecular Formula | C15H12O7 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/m0/s1 |
| InChIKey | CXQWRCVTCMQVQX-LSDHHAIUSA-N |
| SMILES | C1=CC(=C(C=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
