For research use only. Not for therapeutic Use.
Trans-Trimethoxyresveratrol(Cat No.:I002703) is a derivative of Resveratrol (RSV), a natural polyphenolic compound found in various plants. It has been suggested that Trans-Trimethoxyresveratrol may exhibit stronger anti-inflammatory, antiangiogenic, and vascular-disrupting properties compared to resveratrol. These enhanced effects are attributed to the presence of three methoxy groups in its structure. As an anti-inflammatory agent, Trans-Trimethoxyresveratrol holds potential for managing inflammatory conditions. Its antiangiogenic and vascular-disrupting activities may have implications for inhibiting the growth and development of new blood vessels in cancer treatment and other angiogenesis-related diseases.
CAS Number | 22255-22-7 |
Synonyms | (E)-5-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzene diol |
Molecular Formula | C17H18O3 |
Purity | ≥95% |
Target | NF-κB |
Solubility | 100 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | 1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
InChI | InChI=1S/C17H18O3/c1-18-15-8-6-13(7-9-15)4-5-14-10-16(19-2)12-17(11-14)20-3/h4-12H,1-3H3/b5-4+ |
InChIKey | GDHNBPHYVRHYCC-SNAWJCMRSA-N |
SMILES | COC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)OC)OC |
Reference | <p style=/line-height:25px/> </p> |