For research use only. Not for therapeutic Use.
transpDMA(CAT: I012160) is an effective activator of the constitutive androstane receptor (CAR), a nuclear receptor involved in regulating xenobiotic metabolism and energy homeostasis. It inhibits the expression of key gluconeogenic genes, such as PEPCK and G6Pase, by suppressing the transcriptional activities of HNF4α and FOXO1. This dual functionality makes transpDMA particularly valuable in metabolic and pharmacological research, supporting studies on glucose regulation, energy metabolism, and nuclear receptor signaling pathways. Its high purity and reliability ensure consistent results, making it an essential tool for investigating CAR activation and its therapeutic implications in metabolic disorders.
| Catalog Number | I012160 |
| CAS Number | 1360467-27-1 |
| Synonyms | trans-pDMA; trans-4-(4,6-Diphenyl-1,3-dioxan-2-yl)-N,N-dimethylaniline; trans-4-(4,6-Diphenyl-1,3-dioxan-2-yl])-N,N-dimethyl-benzenamine |
| Molecular Formula | C24H25NO2 |
| Purity | ≥95% |
| IUPAC Name | 4-[(4R,6R)-4,6-diphenyl-1,3-dioxan-2-yl]-N,N-dimethylaniline |
| InChI | InChI=1S/C24H25NO2/c1-25(2)21-15-13-20(14-16-21)24-26-22(18-9-5-3-6-10-18)17-23(27-24)19-11-7-4-8-12-19/h3-16,22-24H,17H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | SJRMPIVJJKXQPC-DHIUTWEWSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2OC(CC(O2)C3=CC=CC=C3)C4=CC=CC=C4 |
