Tranylcypromine Hemisulfate（Cat No.:I001341） is a potent monoamine oxidase inhibitor (MAOI) used primarily in the treatment of major depressive disorder. By inhibiting the enzyme monoamine oxidase, it increases the levels of neurotransmitters such as serotonin, norepinephrine, and dopamine in the brain, thereby improving mood and alleviating depressive symptoms. Tranylcypromine Hemisulfate is particularly effective in patients who have not responded to other antidepressants. Its unique mechanism of action makes it a valuable option in the management of depression, offering an alternative when conventional treatments fail.
| Catalog Number | I001341 |
| CAS Number | 13492-01-8 |
| Molecular Formula | C₉H₁₁N.1/2H₂SO₄ |
| Purity | ≥95% |
| Solubility | H2O: 25 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | (1R,2S)-2-phenylcyclopropan-1-amine;sulfuric acid |
| InChI | InChI=1S/2C9H11N.H2O4S/c2*10-9-6-8(9)7-4-2-1-3-5-7;1-5(2,3)4/h2*1-5,8-9H,6,10H2;(H2,1,2,3,4)/t2*8-,9+;/m00./s1 |
| InChIKey | BKPRVQDIOGQWTG-FKXFVUDVSA-N |
| SMILES | C1C(C1N)C2=CC=CC=C2.C1C(C1N)C2=CC=CC=C2.OS(=O)(=O)O |
