For research use only. Not for therapeutic Use.
Trastuzumab（Cat No.:M039374）is a monoclonal antibody used primarily in the treatment of HER2-positive breast cancer. It specifically targets the human epidermal growth factor receptor 2 (HER2), which is overexpressed in some breast cancers, promoting cell growth and division. By binding to the HER2 receptor, trastuzumab inhibits the proliferation of cancer cells and flags them for destruction by the immune system. It has significantly improved outcomes for patients with HER2-positive cancers, making it a critical component of targeted cancer therapy. Trastuzumab is often used in combination with chemotherapy for enhanced efficacy.
| Catalog Number | M039374 |
| CAS Number | 180288-69-1 |
| Molecular Formula | C10H14N6O5 |
| Purity | ≥95% |
| Target | HER2 receptor |
| Storage | Desiccate at -20C |
| IUPAC Name | 2,8-diamino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChI | InChI=1S/C10H14N6O5/c11-9-14-6-3(7(20)15-9)13-10(12)16(6)8-5(19)4(18)2(1-17)21-8/h2,4-5,8,17-19H,1H2,(H2,12,13)(H3,11,14,15,20) |
| InChIKey | FNXPTCITVCRFRK-UHFFFAOYSA-N |
| SMILES | C(C1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)N=C2N)O)O)O |
