For research use only. Not for therapeutic Use.
Trehalose is a disaccharide sugar composed of two glucose molecules linked together. This naturally occurring sugar is found in various organisms, including bacteria, fungi, plants, and invertebrates, where it serves as a protective agent against stressors like heat, cold, and desiccation. Trehalose is used in food and cosmetic products as a stabilizer and moisturizer due to its ability to retain water and protect against moisture loss. In biomedical applications, trehalose has potential therapeutic uses, including as a cryoprotectant and in treatments for neurodegenerative diseases. Ongoing research explores its diverse applications across industries.
CAS Number | 99-20-7 |
Molecular Formula | C12H22O11 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol |
InChI | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
InChIKey | HDTRYLNUVZCQOY-LIZSDCNHSA-N |
SMILES | C(C1C(C(C(C(O1)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |