For research use only. Not for therapeutic Use.
Tri-n-propyl boron (Cat No.:M050547) is an organoboron compound with the chemical formula B(C3H7)3, where three n-propyl groups are bonded to a central boron atom. This clear, colorless liquid is used primarily in organic synthesis, particularly in transition metal-catalyzed reactions such as cross-coupling processes. Its utility arises from its ability to act as a boron source, facilitating the formation of carbon-boron bonds which are pivotal in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Additionally, tri-n-propyl boron serves as a reagent in the preparation of other boron-containing compounds.
CAS Number | 1116-61-6 |
Molecular Formula | C9H21B |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tripropylborane |
InChI | InChI=1S/C9H21B/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
InChIKey | ZMPKTELQGVLZTD-UHFFFAOYSA-N |
SMILES | B(CCC)(CCC)CCC |