For research use only. Not for therapeutic Use.
Tri-O-benzyl-D-glucal (CAT: R037183) is a chemical compound commonly employed in organic chemistry synthesis. It is notable for its role as a versatile protecting group for carbohydrate derivatives. By introducing benzyl groups at multiple positions on the glucal molecule, it provides stability and protection to specific functional groups during chemical reactions. This protection allows chemists to manipulate and modify carbohydrates selectively, making it a valuable tool in the field of organic chemistry.
CAS Number | 55628-54-1 |
Synonyms | 1,5-Anhydro-2-deoxy-3,4,6-tris-O-(phenylmethyl)-D-arabino-hex-1-enitol; (3R,4S,5R)-3,4,6-Tri-O-benzyl-D-glucal; 3,4,6-Tri-O-benzyl-D-glucal; 1,5-Anhydro-2-deoxy-3,4,6-tris-O-(phenylmethyl)-D-arabino-Hex-1-enitol |
Molecular Formula | C27H28O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
InChI | InChI=1S/C27H28O4/c1-4-10-22(11-5-1)18-28-21-26-27(31-20-24-14-8-3-9-15-24)25(16-17-29-26)30-19-23-12-6-2-7-13-23/h1-17,25-27H,18-21H2/t25-,26-,27+/m1/s1 |
InChIKey | MXYLLYBWXIUMIT-PFBJBMPXSA-N |
SMILES | C1=CC=C(C=C1)COCC2C(C(C=CO2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |