For research use only. Not for therapeutic Use.
Tri-o-tolyl phosphine oxide (Cat No.:C000813) is a chemical compound featuring three o-tolyl (ortho-tolyl) groups attached to a phosphine oxide functional group. This molecule finds applications as a ligand in coordination chemistry and catalysis due to its ability to form stable complexes with transition metals. Its unique structure and electronic properties contribute to its effectiveness in facilitating various chemical reactions. Researchers harness its coordination capabilities in designing new catalytic processes for organic synthesis, such as cross-coupling reactions and C-H activation. The compound’s utility in facilitating controlled and efficient transformations underscores its importance in advancing synthetic methodologies and the production of valuable compounds.
CAS Number | 6163-63-9 |
Synonyms | Tris(2-methylphenyl)phosphine Oxide; NSC 299861;Tri(o-methylphenyl)phosphine Monoxide; Tri-o-tolylphosphine Oxide; Eletriptan Impurity 14; Tris(2-tolyl)phosphine Oxide; Tris(o-tolyl)phosphine Oxide |
Molecular Formula | C₂₁H₂₁OP |
Purity | ≥95% |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | -20°C, Inert atmosphere |
IUPAC Name | 1-bis(2-methylphenyl)phosphoryl-2-methylbenzene |
InChI | InChI=1S/C21H21OP/c1-16-10-4-7-13-19(16)23(22,20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
InChIKey | VGSVITFVAXDZAL-UHFFFAOYSA-N |
SMILES | CC1=CC=CC=C1P(=O)(C2=CC=CC=C2C)C3=CC=CC=C3C |
Reference | Willems, E., et al.: Arch. Pharmacol., 358, 212 (1998); Napier, C., et al.: Eur. J. Pharmacol., 368, 259 (1999); Goadsby, P.J., et al.: Neurology, 54, 156 (2000) |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |