For research use only. Not for therapeutic Use.
Triacetylresveratrol(Cat No.:L006875), is a derivative of resveratrol, a natural polyphenol found in plants. Triacetylresveratrol is synthesized by acetylating resveratrol, a compound known for its antioxidant and potential health benefits. Triacetylresveratrol is used in pharmaceutical and cosmetic industries due to its enhanced stability and solubility compared to resveratrol. Its applications include the development of antioxidant supplements, skincare products, and potential therapeutic agents.
CAS Number | 54443-64-0 |
Molecular Formula | C20H18O6 |
Purity | ≥95% |
IUPAC Name | [4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenyl] acetate |
InChI | InChI=1S/C20H18O6/c1-13(21)24-18-8-6-16(7-9-18)4-5-17-10-19(25-14(2)22)12-20(11-17)26-15(3)23/h4-12H,1-3H3/b5-4+ |
InChIKey | PDAYUJSOJIMKIS-SNAWJCMRSA-N |
SMILES | CC(=O)OC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)OC(=O)C)OC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |