Triamcinolone-¹³C₃ Acetonide is a carbon-13 labeled form of triamcinolone acetonide, a corticosteroid used to treat inflammatory and autoimmune conditions. The three carbon-13 isotopes replace hydrogen atoms in the molecule, providing a stable isotopic label that enhances its use in metabolic and pharmacokinetic studies. This labeled compound is particularly useful for tracking the drug’s absorption, distribution, metabolism, and excretion in biological systems. Its applications include studying corticosteroid metabolism, optimizing therapeutic strategies, and improving drug formulations. It is valuable in pharmaceutical research and clinical studies for understanding the behavior and interactions of corticosteroids.
| Catalog Number | R009974 |
| CAS Number | 1264131-86-3 |
| Synonyms | (11β,16α)-9-Fluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-pregna-1,4-diene-3,20-dione-13C3; Adcortyl-13C3; Azmacort-13C3; Delphicort-13C3; Extracort-13C3; Ftorocort-13C3; Kenacort-A-13C3; Tramacin-13C3; Triam-13C3; |
| Molecular Formula | C24H31FO6 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (1S,9S,11S,13S)-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6,6-di((113C)methyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| InChI | InChI=1S/C24H31FO6/c1-20(2)30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,3)23(15,25)17(28)11-22(16,4)24(19,31-20)18(29)12-26/h7-9,15-17,19,26,28H,5-6,10-12H2,1-4H3/t15-,16-,17-,19+,21-,22-,23-,24+/m0/s1/i1+1,2+1,20+1 |
| InChIKey | YNDXUCZADRHECN-FIENXHBESA-N |
| SMILES | C[C@]12C[C@@H](C3([C@H](C1CC4C2(O[13C](O4)([13CH3])[13CH3])C(=O)CO)CCC5=CC(=O)C=C[C@@]53C)F)O |
