For research use only. Not for therapeutic Use.
Triazolopyridinone (Cat No.:C000748) is a heterocyclic compound characterized by a fused triazole and pyridine ring system. This structural arrangement imparts diverse properties and potential applications. Triazolopyridinone derivatives have been explored in medicinal chemistry for their biological activities, including antimicrobial, antiviral, and anticancer effects. These compounds often exhibit significant interactions with biological targets, making them valuable for drug discovery efforts.
| Catalog Number | C000748 |
| CAS Number | 23431-04-1 |
| Synonyms | 1H-[1,2,3]Triazolo[4,5-b]pyridin-5(4H)-one; 3,4-Dihydro-5H-1,2,3-triazolo[4,5-b]pyridin-5-one; 1H-v-Triazolo[4,5-b]pyridin-5-ol; |
| Molecular Formula | C₅H₄N₄O |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| Appearance | Light Brown to Brown Solid |
| Storage | 4°C, Inert atmosphere, Light sensitive |
| IUPAC Name | 2,4-dihydrotriazolo[4,5-b]pyridin-5-one |
| InChI | InChI=1S/C5H4N4O/c10-4-2-1-3-5(6-4)8-9-7-3/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | FITNPEDFWSPOMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=NNN=C21 |
| Reference | Lynch, B. M. et al.: Can. J. Chem., 54, 1029 (1976) |
