For research use only. Not for therapeutic Use.
Tribenzylphosphine（Cat No.:L006920）, is an organophosphorus compound. It consists of a phosphorus atom bonded to three benzyl (C6H5CH2) groups. This compound is widely used as a ligand in organometallic chemistry and catalysis. Due to its bulky and electron-donating nature, triphenylphosphine is valuable in stabilizing metal complexes and enhancing catalytic activity. It is utilized in various reactions, such as hydrogenation, cross-coupling, and asymmetric synthesis.
| Catalog Number | L006920 |
| CAS Number | 7650-89-7 |
| Molecular Formula | C21H21P |
| Purity | ≥95% |
| IUPAC Name | tribenzylphosphane |
| InChI | InChI=1S/C21H21P/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15H,16-18H2 |
| InChIKey | IFXORIIYQORRMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CP(CC2=CC=CC=C2)CC3=CC=CC=C3 |
