For research use only. Not for therapeutic Use.
Tribenzylphosphite（Cat No.:M075491）, is a chemical compound used primarily as a reagent in organic synthesis and chemical reactions. It belongs to the family of organophosphorus compounds and contains three benzyl groups attached to a phosphite group. This compound is valuable in various reactions, including those involving the synthesis of organic molecules and polymers. Tribenzylphosphite is particularly important in the preparation of phosphite-based ligands for catalytic processes and is a versatile tool for chemists and researchers in the development of complex organic compounds and materials. Its reactivity and stability make it a valuable reagent in organic chemistry.
| Catalog Number | M075491 |
| CAS Number | 15205-57-9 |
| Molecular Formula | C21H21O3P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | tribenzyl phosphite |
| InChI | InChI=1S/C21H21O3P/c1-4-10-19(11-5-1)16-22-25(23-17-20-12-6-2-7-13-20)24-18-21-14-8-3-9-15-21/h1-15H,16-18H2 |
| InChIKey | KKFOMYPMTJLQGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COP(OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
