For research use only. Not for therapeutic Use.
Tribuloside（Cat No.:I018246）is a bioactive flavonoid glycoside primarily found in Tribulus terrestris, a plant known for its traditional medicinal uses. It exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and cardioprotective effects. Tribuloside is studied for its potential to modulate lipid metabolism, making it valuable in research related to cardiovascular health and metabolic disorders. Additionally, it has shown promise in neuroprotection and immune modulation, adding to its potential in therapeutic applications. As a natural compound, Tribuloside is of interest in nutraceutical and herbal supplement development targeting wellness and disease prevention.
| Catalog Number | I018246 |
| CAS Number | 22153-44-2 |
| Molecular Formula | C₃₀H₂₆O₁₃ |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C, protect from light |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26+,27-,30+/m1/s1 |
| InChIKey | DVGGLGXQSFURLP-VWMSDXGPSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
| Reference | [1]. Yinlin Cao, et al. Medicine composition with total tribuloside possessing effect similar to female bormone and its prepn process. Patent CN1706469A<br>[2]. Christopher R, et al. A new cinnamoylglycoflavonoid, antimycobacterial and antioxidant constituents from Heritiera littoralis leaf extracts. Nat Prod Res. 2014;28(6):351-8. |
