For research use only. Not for therapeutic Use.
Tributyl[2-(methoxycarbonyl)ethyl]stannane(Cat No.:M130988) is an organotin compound used in organic synthesis as a source of nucleophilic carbon radicals. It contains a tin atom bonded to three butyl groups and a 2-(methoxycarbonyl)ethyl group. This compound is often employed in radical reactions for carbon-carbon bond formation, such as in Stille couplings, where it serves as a partner to couple with organic halides or pseudohalides under palladium catalysis. The presence of the 2-(methoxycarbonyl)ethyl group provides stability and solubility to the compound, making it a useful reagent in various synthetic methodologies for the preparation of complex organic molecules.
CAS Number | 19464-44-9 |
Molecular Formula | C16H34O2Sn |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | methyl 3-tributylstannylpropanoate |
InChI | InChI=1S/C4H7O2.3C4H9.Sn/c1-3-4(5)6-2;3*1-3-4-2;/h1,3H2,2H3;3*1,3-4H2,2H3; |
InChIKey | RZUQMUOSYHWODC-UHFFFAOYSA-N |
SMILES | CCCC[Sn](CCCC)(CCCC)CCC(=O)OC |