For research use only. Not for therapeutic Use.
Tributyrin(Cat No.: R027549) is an ester of butyric acid and glycerol, commonly used as a source of butyrate, a short-chain fatty acid with various health benefits. It is primarily studied for its role in gut health, as butyrate is a key energy source for colon cells and has anti-inflammatory properties. Tributyrin is thought to promote healthy gut microbiota, support the intestinal barrier, and reduce inflammation. It is also being explored for its potential benefits in metabolic disorders, cancer, and neurological health.
| Catalog Number | R027549 |
| CAS Number | 60-01-5 |
| Synonyms | Glyceryl Tributyrate; Butyrin; Butyryl triglyceride; Glycerin tributyrate; Glycerol tributanoate; Glycerol tributyrate; Glyceroltributyrin; Glyceryl tributanoate; Glyceryl tributyrate; NSC 661583; Tri-n-butyrin; Tributanoin; Tributin; Tributyroin; Tr |
| Molecular Formula | C15H26O6 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | 2,3-di(butanoyloxy)propyl butanoate |
| InChI | InChI=1S/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | UYXTWWCETRIEDR-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
