For research use only. Not for therapeutic Use.
Tricaprylin (Cat. No: R029873) is a plant extract, that can be used as pharmaceutical intermediates or daily chemical use, and is widely used in cosmetics products.
| Catalog Number | R029873 |
| CAS Number | 538-23-8 |
| Synonyms | Caprylic Acid Triglyceride; Caprylic Triglyceride; Captex 8000; Coconad RK; Delios 888; Emalex KTG; Glycerin Tricaprylate; Glycerin Trioctanoate; Glycerol Tricaprylate; Glycerol Trioctanoate; Glyceryl Tricaprylate; Glyceryl Trioctanoate; Hest TC; Hex |
| Molecular Formula | C27H50O6 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Desiccate at 4°C |
| IUPAC Name | 2,3-di(octanoyloxy)propyl octanoate |
| InChI | InChI=1S/C27H50O6/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h24H,4-23H2,1-3H3 |
| InChIKey | VLPFTAMPNXLGLX-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
