For research use only. Not for therapeutic Use.
Tricetin(CAT: M198127) is a natural compound belonging to the class of flavonoids. Its mode of action and pharmacological effects involve interactions with cellular receptors and molecular pathways due to its specific chemical structure. Tricetin has been studied for its potential bioactivities, including antioxidant, anti-inflammatory, and anticancer properties. It also exhibits potential in modulating cellular signaling pathways and enzyme activities. Its applications extend to natural product research, dietary supplements, and the development of functional foods, where it holds promise for various health-related uses.
| Catalog Number | M198127 |
| CAS Number | 520-31-0 |
| Molecular Formula | C15H10O7 |
| Purity | ≥95% |
| Target | NF-κB |
| IUPAC Name | 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H |
| InChIKey | ARSRJFRKVXALTF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
