For research use only. Not for therapeutic Use.
Tricin(Cat No.:R031511)is a flavonoid compound with potential antioxidant, anti-inflammatory, and anticancer properties. It is found in various plants, including rice and sorghum, and has shown promise in modulating key biochemical pathways involved in cell growth and apoptosis. Research suggests that Tricin may inhibit the proliferation of cancer cells and reduce oxidative stress, making it a potential candidate for therapeutic applications in cancer and inflammatory diseases. With its unique structure and bioactivity, Tricin is gaining interest in the development of natural product-based pharmaceuticals.
CAS Number | 520-32-1 |
Molecular Formula | C17H14O7 |
Purity | ≥95% |
Target | CMV |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
InChI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3 |
InChIKey | HRGUSFBJBOKSML-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
Reference | <p> |