For research use only. Not for therapeutic Use.
Triclabendazole（Cat No.:A000387）is a broad-spectrum antiparasitic agent primarily used for the treatment of fascioliasis, a parasitic infection caused by liver flukes. It works by inhibiting microtubule formation in the parasite, leading to its death. Triclabendazole is particularly effective against both immature and adult stages of Fasciola hepatica and Fasciola gigantica, making it the preferred treatment for liver fluke infections in humans and animals. Its unique mechanism of action and efficacy in targeting resistant fluke populations make it an important compound in parasitology and veterinary medicine research.
| Catalog Number | A000387 |
| CAS Number | 68786-66-3 |
| Synonyms | CGA-89317 |
| Molecular Formula | C14H9Cl3N2OS |
| Purity | 98% |
| Target | Excretory Secretory (ES) proteins (Protein Group) |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IC50 | Triclabendazole (20-320 μM, 24-48 h) has cytotoxicity on MCF-7 and MDA-MB-231 cells |
| IUPAC Name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole |
| InChI | InChI=1S/C14H9Cl3N2OS/c1-21-14-18-9-5-8(16)12(6-10(9)19-14)20-11-4-2-3-7(15)13(11)17/h2-6H,1H3,(H,18,19) |
| InChIKey | NQPDXQQQCQDHHW-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=CC(=C(C=C2N1)Cl)OC3=C(C(=CC=C3)Cl)Cl |
