Triclocarban-d4(Cat No.:S001136) is a deuterated variant of Triclocarban, where four hydrogen atoms are replaced with deuterium, enhancing its chemical stability and making it a valuable tool in environmental and toxicological studies. This isotopically labeled compound is crucial for tracing and studying the persistence and bioaccumulation of Triclocarban, a common antimicrobial agent in personal care products. Utilized in advanced analytical techniques like mass spectrometry, Triclocarban-d4 helps in detecting low levels of environmental contaminants, aiding in the assessment of ecological risks and the environmental impact of persistent organic pollutants.
Catalog Number | S001136 |
CAS Number | 1219799-29-7 |
Molecular Formula | C13H5D4Cl3N2O |
Purity | ≥95% |
IUPAC Name | 1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-3-(3,4-dichlorophenyl)urea |
InChI | InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19)/i1D,2D,3D,4D |
InChIKey | ICUTUKXCWQYESQ-RHQRLBAQSA-N |
SMILES | C1=CC(=CC=C1NC(=O)NC2=CC(=C(C=C2)Cl)Cl)Cl |