For research use only. Not for therapeutic Use.
Triclosan Methyl-d3 Ether(Cat No.: R002373) is a deuterium-labeled derivative of triclosan, a synthetic antibacterial and antifungal agent commonly used in personal care products, such as soaps, toothpaste, and hand sanitizers. Its mode of action involves disrupting bacterial and fungal cell membranes, leading to their inhibition and killing. Triclosan Methyl-d3 Ether is used as a labeled internal standard in analytical chemistry and bioanalytical studies. By using deuterium-labeled compounds like Triclosan Methyl-d3 Ether as internal standards, researchers can accurately quantify and identify triclosan and related compounds in complex samples using various analytical techniques, such as mass spectrometry.
CAS Number | 1020720-00-6 |
Synonyms | Methyl-d3 Ether Triclosan |
Molecular Formula | C₁₃H₆D₃Cl₃O₂ |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 2,4-dichloro-1-[4-chloro-2-(trideuteriomethoxy)phenoxy]benzene |
InChI | InChI=1S/C13H9Cl3O2/c1-17-13-7-9(15)3-5-12(13)18-11-4-2-8(14)6-10(11)16/h2-7H,1H3/i1D3 |
InChIKey | NLYDHBBTVWMLFD-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)Cl)OC2=C(C=C(C=C2)Cl)Cl |